CAS 874202-33-2 appears in our catalog under these names: 7-(benzyloxy)- 3-hydroxy-5-m ethoxy-2-(4-m ethoxyphenyl)- 4H-chromen-4 -one, 97%, 97%, 7-(benzyloxy)- 3-hydroxy-5-m ethoxy-2-(4-m ethoxyphenyl)- 4H-chromen-4 -one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-hydroxy-5-methoxy-2-(4-methoxyphenyl)-7-phenylmethoxychromen-4-one (CAS 874202-33-2) is a chemical compound with the molecular formula C24H20O6 and a molecular weight of 404.4 g/mol. IUPAC name: 3-hydroxy-5-methoxy-2-(4-methoxyphenyl)-7-phenylmethoxychromen-4-one. InChIKey: IWRBCCIPJILBJB-UHFFFAOYSA-N.
| Molecular formula | C24H20O6 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 3-hydroxy-5-methoxy-2-(4-methoxyphenyl)-7-phenylmethoxychromen-4-one |
| InChIKey | IWRBCCIPJILBJB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OCC4=CC=CC=C4)O |
Computed by PubChem (NCBI)