CAS 25241-16-1 appears in our catalog under these names: 2,3-Dimethylbenzenesulfonic acid, 97%, 2,3-Dimethylbenzenesulfonic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 0,25g.
2,3-dimethylbenzenesulfonic acid (CAS 25241-16-1) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: 2,3-dimethylbenzenesulfonic acid. InChIKey: ZZXDRXVIRVJQBT-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | 2,3-dimethylbenzenesulfonic acid |
| InChIKey | ZZXDRXVIRVJQBT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)O)C |
Computed by PubChem (NCBI)