CAS 252570-34-6 is the registry number for rac 4’-Hydroxy Reboxetine. Offered by: TRC. Available pack sizes: 250mg.
3-ethoxy-4-[(R)-[(2R)-morpholin-2-yl]-phenylmethoxy]phenol (CAS 252570-34-6) is a chemical compound with the molecular formula C19H23NO4 and a molecular weight of 329.4 g/mol. IUPAC name: 3-ethoxy-4-[(R)-[(2R)-morpholin-2-yl]-phenylmethoxy]phenol. InChIKey: KWIARTUNLAUWCQ-RTBURBONSA-N.
| Molecular formula | C19H23NO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 3-ethoxy-4-[(R)-[(2R)-morpholin-2-yl]-phenylmethoxy]phenol |
| InChIKey | KWIARTUNLAUWCQ-RTBURBONSA-N |
| SMILES | CCOC1=C(C=CC(=C1)O)O[C@@H]([C@H]2CNCCO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)