Products 252573-80-1
CAS 252573-80-1 appears in our catalog under these names: Z–Gly–Ile–Ala–OH, Z-Gly-Ile-Ala-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 1000mg, 2000mg, 5000mg.
(2S)-2-[[(2S,3S)-3-methyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]propanoic acid (CAS 252573-80-1) is a chemical compound with the molecular formula C19H27N3O6 and a molecular weight of 393.4 g/mol. IUPAC name: (2S)-2-[[(2S,3S)-3-methyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]propanoic acid. InChIKey: AMALWJTXQRCTGO-XEZPLFJOSA-N.
| Molecular formula | C19H27N3O6 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | (2S)-2-[[(2S,3S)-3-methyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]propanoic acid |
| InChIKey | AMALWJTXQRCTGO-XEZPLFJOSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)CNC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)