CAS 252638-01-0 appears in our catalog under these names: Levosimendan Impurity (2-(2-(4-(2-Azidotetrahydro-3-Methyl-5-oxo-2-Furanyl)phenyl)hydrazinylidene)propanedinitrile), Levosimendan Impurity 14, Levosimendan Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[4-(2-azido-3-methyl-5-oxooxolan-2-yl)phenyl]hydrazinylidene]propanedinitrile (CAS 252638-01-0) is a chemical compound with the molecular formula C14H11N7O2 and a molecular weight of 309.28 g/mol. IUPAC name: 2-[[4-(2-azido-3-methyl-5-oxooxolan-2-yl)phenyl]hydrazinylidene]propanedinitrile. InChIKey: KWFMPQFMZALWEW-UHFFFAOYSA-N.
| Molecular formula | C14H11N7O2 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 2-[[4-(2-azido-3-methyl-5-oxooxolan-2-yl)phenyl]hydrazinylidene]propanedinitrile |
| InChIKey | KWFMPQFMZALWEW-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)OC1(C2=CC=C(C=C2)NN=C(C#N)C#N)N=[N+]=[N-] |
Computed by PubChem (NCBI)