CAS 4752-84-5 appears in our catalog under these names: Dihydrocodeine Phosphate, Dihydrocodeine Phosphate (1.0mg/ml in Methanol). Offered by: TRC. Available pack sizes: 10mg, 1x1ml.
2-[[4-(2-azido-3-methyl-5-oxooxolan-2-yl)phenyl]hydrazinylidene]propanedinitrile (CAS 4752-84-5) is a chemical compound with the molecular formula C14H11N7O2 and a molecular weight of 309.28 g/mol. IUPAC name: 2-[[4-(2-azido-3-methyl-5-oxooxolan-2-yl)phenyl]hydrazinylidene]propanedinitrile. InChIKey: KWFMPQFMZALWEW-UHFFFAOYSA-N.
| Molecular formula | C14H11N7O2 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 2-[[4-(2-azido-3-methyl-5-oxooxolan-2-yl)phenyl]hydrazinylidene]propanedinitrile |
| InChIKey | KWFMPQFMZALWEW-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)OC1(C2=CC=C(C=C2)NN=C(C#N)C#N)N=[N+]=[N-] |
Computed by PubChem (NCBI)