CAS 252679-72-4 is the registry number for 4-Phenyl-5-(phenylsulfonyl)thiazol-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-(benzenesulfonyl)-4-phenyl-1,3-thiazol-2-amine (CAS 252679-72-4) is a chemical compound with the molecular formula C15H12N2O2S2 and a molecular weight of 316.4 g/mol. IUPAC name: 5-(benzenesulfonyl)-4-phenyl-1,3-thiazol-2-amine. InChIKey: BRJSVXQOZIYKGH-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2S2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 5-(benzenesulfonyl)-4-phenyl-1,3-thiazol-2-amine |
| InChIKey | BRJSVXQOZIYKGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)N)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)