Products 792904-56-4
CAS 792904-56-4 is the registry number for 3-(phenylamino)-2-(phenylsulfonyl)-3-sulfanylprop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-3-anilino-2-(benzenesulfonyl)-3-sulfanylprop-2-enenitrile (CAS 792904-56-4) is a chemical compound with the molecular formula C15H12N2O2S2 and a molecular weight of 316.4 g/mol. IUPAC name: (E)-3-anilino-2-(benzenesulfonyl)-3-sulfanylprop-2-enenitrile. InChIKey: WGOLUKNPDPFBKQ-CCEZHUSRSA-N.
| Molecular formula | C15H12N2O2S2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (E)-3-anilino-2-(benzenesulfonyl)-3-sulfanylprop-2-enenitrile |
| InChIKey | WGOLUKNPDPFBKQ-CCEZHUSRSA-N |
| SMILES | C1=CC=C(C=C1)N/C(=C(/C#N)\S(=O)(=O)C2=CC=CC=C2)/S |
Computed by PubChem (NCBI)