CAS 252720-16-4 appears in our catalog under these names: 3-Hydroxy Methoxyfenozide, Methoxyfenozide-3-hydroxy. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 25mg.
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methylbenzohydrazide (CAS 252720-16-4) is a chemical compound with the molecular formula C21H26N2O3 and a molecular weight of 354.4 g/mol. IUPAC name: N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methylbenzohydrazide. InChIKey: BFKZZXWIAWMKQB-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-hydroxy-2-methylbenzohydrazide |
| InChIKey | BFKZZXWIAWMKQB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C(=CC=C2)O)C)C |
Computed by PubChem (NCBI)