CAS 252932-95-9 appears in our catalog under these names: Gemcitabine Impurity 11, 2'-Deoxy-2',2'-difluoro-b-D-ribofuranose. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg, 1000mg.
(2R,4R,5R)-3,3-difluoro-5-(hydroxymethyl)oxolane-2,4-diol (CAS 252932-95-9) is a chemical compound with the molecular formula C5H8F2O4 and a molecular weight of 170.11 g/mol. IUPAC name: (2R,4R,5R)-3,3-difluoro-5-(hydroxymethyl)oxolane-2,4-diol. InChIKey: LDHXMQXUOUZOLF-BXXZVTAOSA-N.
| Molecular formula | C5H8F2O4 |
|---|---|
| Molecular weight | 170.11 g/mol |
| IUPAC name | (2R,4R,5R)-3,3-difluoro-5-(hydroxymethyl)oxolane-2,4-diol |
| InChIKey | LDHXMQXUOUZOLF-BXXZVTAOSA-N |
| SMILES | C([C@@H]1[C@H](C([C@@H](O1)O)(F)F)O)O |
Computed by PubChem (NCBI)