CAS 95058-90-5 is the registry number for (3R,4R)-2,2-Difluoro-3,4,5-trihydroxypentanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-2,2-difluoro-3,4,5-trihydroxypentanal (CAS 95058-90-5) is a chemical compound with the molecular formula C5H8F2O4 and a molecular weight of 170.11 g/mol. IUPAC name: (3R,4R)-2,2-difluoro-3,4,5-trihydroxypentanal. InChIKey: WFMBOGWJPNESIL-QWWZWVQMSA-N.
| Molecular formula | C5H8F2O4 |
|---|---|
| Molecular weight | 170.11 g/mol |
| IUPAC name | (3R,4R)-2,2-difluoro-3,4,5-trihydroxypentanal |
| InChIKey | WFMBOGWJPNESIL-QWWZWVQMSA-N |
| SMILES | C([C@H]([C@H](C(C=O)(F)F)O)O)O |
Computed by PubChem (NCBI)