Products 253273-95-9
CAS 253273-95-9 is the registry number for 3,6-Dibutyl-1-naphthalenesulfonic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 100mg.
Sodium 3,6-dibutylnaphthalene-1-sulfonate (CAS 253273-95-9) is a chemical compound with the molecular formula C18H23NaO3S and a molecular weight of 342.4 g/mol. IUPAC name: sodium 3,6-dibutylnaphthalene-1-sulfonate. InChIKey: SRAWNDFHGTVUNZ-UHFFFAOYSA-M.
| Molecular formula | C18H23NaO3S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | sodium 3,6-dibutylnaphthalene-1-sulfonate |
| InChIKey | SRAWNDFHGTVUNZ-UHFFFAOYSA-M |
| SMILES | CCCCC1=CC2=C(C=C1)C(=CC(=C2)CCCC)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Nekal BX-78, Sodium dibutylnaphthylsulfonate, Sodium dibutylnapthalenesulfonate, Sodium dibutylnaphthalene sulfate, Naftalin-butil-solfonato, Naftalin-butil-solfonato [Italian], Dibutyl-naphthalene sulfate, sodium salt, sodium 3,6-dibutylnaphthalene-1-sulfonate, Dibutylnaphthalenesulfonic acid sodium salt, sodium;3,6-dibutylnaphthalene-1-sulfonate