CAS 27213-90-7 appears in our catalog under these names: Sodium Diisobutylnaphthalenesulphonate, Bis(2-methylpropyl)naphthalenesulfonic acid sodium salt. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1kg, 250g.
Sodium 2,3-bis(2-methylpropyl)naphthalene-1-sulfonate (CAS 27213-90-7) is a chemical compound with the molecular formula C18H23NaO3S and a molecular weight of 342.4 g/mol. IUPAC name: sodium 2,3-bis(2-methylpropyl)naphthalene-1-sulfonate. InChIKey: PYODKQIVQIVELM-UHFFFAOYSA-M.
| Molecular formula | C18H23NaO3S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | sodium 2,3-bis(2-methylpropyl)naphthalene-1-sulfonate |
| InChIKey | PYODKQIVQIVELM-UHFFFAOYSA-M |
| SMILES | CC(C)CC1=CC2=CC=CC=C2C(=C1CC(C)C)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)