CAS 253443-43-5 appears in our catalog under these names: 5-(Chloromethyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole, 95%, 5-(Chloromethyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(chloromethyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole (CAS 253443-43-5) is a chemical compound with the molecular formula C10H9ClFNO and a molecular weight of 213.63 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole. InChIKey: WCZFVCMOANNSEE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO |
|---|---|
| Molecular weight | 213.63 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
| InChIKey | WCZFVCMOANNSEE-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=C(C=C2)F)CCl |
Computed by PubChem (NCBI)