CAS 60610-98-2 appears in our catalog under these names: 4–(2–Chloro–6–fluorophenyl)pyrrolidin–2–one, 4-(2-Chloro-6-fluorophenyl)pyrrolidin-2-one, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
4-(2-chloro-6-fluorophenyl)pyrrolidin-2-one (CAS 60610-98-2) is a chemical compound with the molecular formula C10H9ClFNO and a molecular weight of 213.63 g/mol. IUPAC name: 4-(2-chloro-6-fluorophenyl)pyrrolidin-2-one. InChIKey: BEYHRDFBLQUXIG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO |
|---|---|
| Molecular weight | 213.63 g/mol |
| IUPAC name | 4-(2-chloro-6-fluorophenyl)pyrrolidin-2-one |
| InChIKey | BEYHRDFBLQUXIG-UHFFFAOYSA-N |
| SMILES | C1C(CNC1=O)C2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)