CAS 25364-98-1 is the registry number for 1,1,2-Trifluoro-2-chloroethyl 2,2,2-trifluoroethyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-1,1,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethane (CAS 25364-98-1) is a chemical compound with the molecular formula C4H3ClF6O and a molecular weight of 216.51 g/mol. IUPAC name: 2-chloro-1,1,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethane. InChIKey: SNVWPWRMMAPUJZ-UHFFFAOYSA-N.
| Molecular formula | C4H3ClF6O |
|---|---|
| Molecular weight | 216.51 g/mol |
| IUPAC name | 2-chloro-1,1,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethane |
| InChIKey | SNVWPWRMMAPUJZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(C(F)Cl)(F)F |
Computed by PubChem (NCBI)