CAS 26103-07-1 appears in our catalog under these names: 2-(Chloromethoxy)-1,1,1,3,3,3-hexafluoropropane, 98%, Sevoflurane Impurity 6, 2-(chloromethoxy)-1,1,1,3,3,3-hexafluoropropane, Chloromethyl Hexafluoroisopropyl Ether, Chloromethyl-1,1,1,3,3,3-hexafluoroisopropyl ether, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Fluorochem. Available pack sizes: 100g, 500g, 25g, on request, 1g, 5g.
2-(chloromethoxy)-1,1,1,3,3,3-hexafluoropropane (CAS 26103-07-1) is a chemical compound with the molecular formula C4H3ClF6O and a molecular weight of 216.51 g/mol. IUPAC name: 2-(chloromethoxy)-1,1,1,3,3,3-hexafluoropropane. InChIKey: HHYFUCXZHKDNPT-UHFFFAOYSA-N.
| Molecular formula | C4H3ClF6O |
|---|---|
| Molecular weight | 216.51 g/mol |
| IUPAC name | 2-(chloromethoxy)-1,1,1,3,3,3-hexafluoropropane |
| InChIKey | HHYFUCXZHKDNPT-UHFFFAOYSA-N |
| SMILES | C(OC(C(F)(F)F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)