CAS 25365-96-2 is the registry number for 3,3-Dimethyl-2,3,4,9-tetrahydro-1H-carbazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-dimethyl-1,2,4,9-tetrahydrocarbazole (CAS 25365-96-2) is a chemical compound with the molecular formula C14H17N and a molecular weight of 199.29 g/mol. IUPAC name: 3,3-dimethyl-1,2,4,9-tetrahydrocarbazole. InChIKey: SYWARFLAJOBABR-UHFFFAOYSA-N.
| Molecular formula | C14H17N |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | 3,3-dimethyl-1,2,4,9-tetrahydrocarbazole |
| InChIKey | SYWARFLAJOBABR-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)C3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)