Products 25368-09-6
CAS 25368-09-6 appears in our catalog under these names: Crocetin monomethyl ester, 98.02%, 98.02%, Crocetin monomethyl ester (Standard), Crocetin monomethyl ester, 98.44%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 20mg, Get quote, 10mM/1mL, 1 mg, 5 mg.
16-methoxy-2,6,11,15-tetramethyl-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoic acid (CAS 25368-09-6) is a chemical compound with the molecular formula C21H26O4 and a molecular weight of 342.4 g/mol. IUPAC name: 16-methoxy-2,6,11,15-tetramethyl-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoic acid. InChIKey: DGGQUKOLHQXDLV-UHFFFAOYSA-N.
| Molecular formula | C21H26O4 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 16-methoxy-2,6,11,15-tetramethyl-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoic acid |
| InChIKey | DGGQUKOLHQXDLV-UHFFFAOYSA-N |
| SMILES | CC(=CC=CC=C(C)C=CC=C(C)C(=O)OC)C=CC=C(C)C(=O)O |
Computed by PubChem (NCBI)