CAS 253783-04-9 is the registry number for (1S,2S)-2-(Aminomethyl)cyclopropane-1-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1S,2S)-2-(aminomethyl)cyclopropane-1-carboxylic acid;hydrochloride (CAS 253783-04-9) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. IUPAC name: cis-(1S,2S)-2-(aminomethyl)cyclopropane-1-carboxylic acid;hydrochloride. InChIKey: UJPDAGAIBGOYRB-HJXLNUONSA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | cis-(1S,2S)-2-(aminomethyl)cyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | UJPDAGAIBGOYRB-HJXLNUONSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)CN.Cl |
Computed by PubChem (NCBI)