CAS 25383-07-7 appears in our catalog under these names: Phosphonomycin (r)-1-phenethylamine salt, 95%, Fosfomycin -phenethylamine salt, Fosfomycin Trometamol Impurity 25, Fosfomycin Phenylethylamine, >95% (HPLC), Phosphonomycin (R)-1-phenethylamine salt. Offered by: Combi-blocks, Hubei YoungXin, TRC, TargetMol. Available pack sizes: 5g, 1g, 100mg, 10mg, 25mg, 50mg, 200mg, 500mg.
[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid;(1R)-1-phenylethanamine (CAS 25383-07-7) is a chemical compound with the molecular formula C11H18NO4P and a molecular weight of 259.24 g/mol. IUPAC name: [(2R,3S)-3-methyloxiran-2-yl]phosphonic acid;(1R)-1-phenylethanamine. InChIKey: ODALAXKSIBESFV-PXRNWTNJSA-N.
| Molecular formula | C11H18NO4P |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | [(2R,3S)-3-methyloxiran-2-yl]phosphonic acid;(1R)-1-phenylethanamine |
| InChIKey | ODALAXKSIBESFV-PXRNWTNJSA-N |
| SMILES | C[C@H]1[C@H](O1)P(=O)(O)O.C[C@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)