CAS 68509-49-9 is the registry number for Dextro-phosphonomycin (S)-1-phenethylamine Salt. Offered by: TRC. Available pack sizes: 500mg.
[(2S,3R)-3-methyloxiran-2-yl]phosphonic acid;(1S)-1-phenylethanamine (CAS 68509-49-9) is a chemical compound with the molecular formula C11H18NO4P and a molecular weight of 259.24 g/mol. IUPAC name: [(2S,3R)-3-methyloxiran-2-yl]phosphonic acid;(1S)-1-phenylethanamine. InChIKey: ODALAXKSIBESFV-GWZVCRKESA-N.
| Molecular formula | C11H18NO4P |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | [(2S,3R)-3-methyloxiran-2-yl]phosphonic acid;(1S)-1-phenylethanamine |
| InChIKey | ODALAXKSIBESFV-GWZVCRKESA-N |
| SMILES | C[C@@H]1[C@@H](O1)P(=O)(O)O.C[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)