Products 25391-74-6
CAS 25391-74-6 is the registry number for 5-Methyl-3-nitropyridine-2(1H)-thione, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.
5-methyl-3-nitro-1H-pyridine-2-thione (CAS 25391-74-6) is a chemical compound with the molecular formula C6H6N2O2S and a molecular weight of 170.19 g/mol. IUPAC name: 5-methyl-3-nitro-1H-pyridine-2-thione. InChIKey: FHQQQGHOVLBHIU-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2S |
|---|---|
| Molecular weight | 170.19 g/mol |
| IUPAC name | 5-methyl-3-nitro-1H-pyridine-2-thione |
| InChIKey | FHQQQGHOVLBHIU-UHFFFAOYSA-N |
| SMILES | CC1=CNC(=S)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)