Products 2540797-33-7

CAS 2540797-33-7 is the registry number for 5-Methyl-1-(methylsulfonyl)-1H-pyrrole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-1-methylsulfonylpyrrole-3-carboxylic acid (CAS 2540797-33-7) is a chemical compound with the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. IUPAC name: 5-methyl-1-methylsulfonylpyrrole-3-carboxylic acid. InChIKey: FZTSEJORDUGHQP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4S
Molecular weight203.22 g/mol
IUPAC name5-methyl-1-methylsulfonylpyrrole-3-carboxylic acid
InChIKeyFZTSEJORDUGHQP-UHFFFAOYSA-N
SMILESCC1=CC(=CN1S(=O)(=O)C)C(=O)O

Computed by PubChem (NCBI)