Products 2730026-69-2

CAS 2730026-69-2 is the registry number for 3-Methyl-5-(methylsulfonyl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-methyl-5-methylsulfonyl-1H-pyrrole-2-carboxylic acid (CAS 2730026-69-2) is a chemical compound with the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. IUPAC name: 3-methyl-5-methylsulfonyl-1H-pyrrole-2-carboxylic acid. InChIKey: YJOSYOUGDPBDRU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4S
Molecular weight203.22 g/mol
IUPAC name3-methyl-5-methylsulfonyl-1H-pyrrole-2-carboxylic acid
InChIKeyYJOSYOUGDPBDRU-UHFFFAOYSA-N
SMILESCC1=C(NC(=C1)S(=O)(=O)C)C(=O)O

Computed by PubChem (NCBI)