Products 2541604-52-6
CAS 2541604-52-6 is the registry number for ZC0101. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(E)-3-[2-(1H-imidazol-5-yl)phenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one (CAS 2541604-52-6) is a chemical compound with the molecular formula C17H15N3O2 and a molecular weight of 293.32 g/mol. IUPAC name: 1-[(E)-3-[2-(1H-imidazol-5-yl)phenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one. InChIKey: JJOMQKGDGWAVKI-CMDGGOBGSA-N.
| Molecular formula | C17H15N3O2 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | 1-[(E)-3-[2-(1H-imidazol-5-yl)phenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one |
| InChIKey | JJOMQKGDGWAVKI-CMDGGOBGSA-N |
| SMILES | C1CN(C(=O)C=C1)C(=O)/C=C/C2=CC=CC=C2C3=CN=CN3 |
Computed by PubChem (NCBI)