CAS 2543-95-5 appears in our catalog under these names: (S)–4–Methoxydalbergione, (S)-4-Methoxydalbergione. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
2-methoxy-5-[(1S)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione (CAS 2543-95-5) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 2-methoxy-5-[(1S)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione. InChIKey: RGSUZUQISVAJJF-LBPRGKRZSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2-methoxy-5-[(1S)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| InChIKey | RGSUZUQISVAJJF-LBPRGKRZSA-N |
| SMILES | COC1=CC(=O)C(=CC1=O)[C@@H](C=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)