CAS 25441-16-1 is the registry number for Cinnamedrine Hydrochloride. Offered by: Mikromol. Available pack sizes: 50mg.
2-[methyl-[(E)-3-phenylprop-2-enyl]amino]-1-phenylpropan-1-ol;hydrochloride (CAS 25441-16-1) is a chemical compound with the molecular formula C19H24ClNO and a molecular weight of 317.9 g/mol. IUPAC name: 2-[methyl-[(E)-3-phenylprop-2-enyl]amino]-1-phenylpropan-1-ol;hydrochloride. InChIKey: RSBLYYMNHJDITE-NBYYMMLRSA-N.
| Molecular formula | C19H24ClNO |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | 2-[methyl-[(E)-3-phenylprop-2-enyl]amino]-1-phenylpropan-1-ol;hydrochloride |
| InChIKey | RSBLYYMNHJDITE-NBYYMMLRSA-N |
| SMILES | CC(C(C1=CC=CC=C1)O)N(C)C/C=C/C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)