Products 262425-59-2

CAS 262425-59-2 is the registry number for PBPE (hydrochloride), 99.30%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 10 mg, 50 mg.

Structural formula: {0} (CAS {1})

1-[2-(4-benzylphenoxy)ethyl]pyrrolidine;hydrochloride (CAS 262425-59-2) is a chemical compound with the molecular formula C19H24ClNO and a molecular weight of 317.9 g/mol. IUPAC name: 1-[2-(4-benzylphenoxy)ethyl]pyrrolidine;hydrochloride. InChIKey: ZWMCGZQOUYHEIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H24ClNO
Molecular weight317.9 g/mol
IUPAC name1-[2-(4-benzylphenoxy)ethyl]pyrrolidine;hydrochloride
InChIKeyZWMCGZQOUYHEIQ-UHFFFAOYSA-N
SMILESC1CCN(C1)CCOC2=CC=C(C=C2)CC3=CC=CC=C3.Cl

Computed by PubChem (NCBI)