CAS 25462-67-3 is the registry number for N-(2,5-Dibromo-4-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(2,5-dibromo-4-nitrophenyl)acetamide (CAS 25462-67-3) is a chemical compound with the molecular formula C8H6Br2N2O3 and a molecular weight of 337.95 g/mol. IUPAC name: N-(2,5-dibromo-4-nitrophenyl)acetamide. InChIKey: ILNOMFYNTJKSAM-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O3 |
|---|---|
| Molecular weight | 337.95 g/mol |
| IUPAC name | N-(2,5-dibromo-4-nitrophenyl)acetamide |
| InChIKey | ILNOMFYNTJKSAM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)