CAS 2664046-54-0 is the registry number for 1-(3-Amino-2,4-dibromo-6-nitrophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-amino-2,4-dibromo-6-nitrophenyl)ethanone (CAS 2664046-54-0) is a chemical compound with the molecular formula C8H6Br2N2O3 and a molecular weight of 337.95 g/mol. IUPAC name: 1-(3-amino-2,4-dibromo-6-nitrophenyl)ethanone. InChIKey: ZKRWGVGHWDYUCG-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O3 |
|---|---|
| Molecular weight | 337.95 g/mol |
| IUPAC name | 1-(3-amino-2,4-dibromo-6-nitrophenyl)ethanone |
| InChIKey | ZKRWGVGHWDYUCG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1[N+](=O)[O-])Br)N)Br |
Computed by PubChem (NCBI)