CAS 254900-07-7 appears in our catalog under these names: 2-Oxohexahydro-2h-3,5-methanocyclopenta[b]furan-6-yl methacrylate, 95%, 2–Oxohexahydro–2H–3,5–methanocyclopenta(b)furan–6–yl methacrylate, 2-Oxohexahydro-2H-3,5-methanocyclopenta[b]furan-6-yl Methacrylate, >98.0%(GC), 2-Oxohexahydro-2H-3,5-methanocyclopenta[b]furan-6-yl Methacrylate, 97%, 97%, 2-OXOHEXAHYDRO-2H-3,5-METHANOCYCLOPENTA[B]FURAN-6-YL METHACRYLATE, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g, 10g.
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate (CAS 254900-07-7) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate. InChIKey: JJMQLQLMPJLIPZ-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
| InChIKey | JJMQLQLMPJLIPZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1C2CC3C1OC(=O)C3C2 |
Computed by PubChem (NCBI)