CAS 254902-10-8 is the registry number for LLP6. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(5-chloro-2-hydroxyphenyl)-2-oxo-4-phenyl-1H-pyridine-3-carbonitrile (CAS 254902-10-8) is a chemical compound with the molecular formula C18H11ClN2O2 and a molecular weight of 322.7 g/mol. IUPAC name: 6-(5-chloro-2-hydroxyphenyl)-2-oxo-4-phenyl-1H-pyridine-3-carbonitrile. InChIKey: YMRFUBCTDSEQIF-UHFFFAOYSA-N.
| Molecular formula | C18H11ClN2O2 |
|---|---|
| Molecular weight | 322.7 g/mol |
| IUPAC name | 6-(5-chloro-2-hydroxyphenyl)-2-oxo-4-phenyl-1H-pyridine-3-carbonitrile |
| InChIKey | YMRFUBCTDSEQIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=C2)C3=C(C=CC(=C3)Cl)O)C#N |
Computed by PubChem (NCBI)