CAS 353262-80-3 is the registry number for 6-Chloro-2-(4-pyridinylmethyl)-1H-benz(de)isoquinoline-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 1g.
6-chloro-2-(pyridin-4-ylmethyl)benzo[de]isoquinoline-1,3-dione (CAS 353262-80-3) is a chemical compound with the molecular formula C18H11ClN2O2 and a molecular weight of 322.7 g/mol. IUPAC name: 6-chloro-2-(pyridin-4-ylmethyl)benzo[de]isoquinoline-1,3-dione. InChIKey: UZWICYGNFHCBNH-UHFFFAOYSA-N.
| Molecular formula | C18H11ClN2O2 |
|---|---|
| Molecular weight | 322.7 g/mol |
| IUPAC name | 6-chloro-2-(pyridin-4-ylmethyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | UZWICYGNFHCBNH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)N(C3=O)CC4=CC=NC=C4)Cl |
Computed by PubChem (NCBI)