Products 2549192-46-1

CAS 2549192-46-1 is the registry number for Brexpiprazole Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane hydroxide (CAS 2549192-46-1) is a chemical compound with the molecular formula C16H22N2OS and a molecular weight of 290.4 g/mol. IUPAC name: 8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane hydroxide. InChIKey: ICHKRSFQNUTAPP-UHFFFAOYSA-M.

Identity
Molecular formulaC16H22N2OS
Molecular weight290.4 g/mol
IUPAC name8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane hydroxide
InChIKeyICHKRSFQNUTAPP-UHFFFAOYSA-M
SMILESC1CC[N+]2(C1)CCN(CC2)C3=C4C=CSC4=CC=C3.[OH-]

Computed by PubChem (NCBI)