CAS 2549192-46-1 is the registry number for Brexpiprazole Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane hydroxide (CAS 2549192-46-1) is a chemical compound with the molecular formula C16H22N2OS and a molecular weight of 290.4 g/mol. IUPAC name: 8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane hydroxide. InChIKey: ICHKRSFQNUTAPP-UHFFFAOYSA-M.
| Molecular formula | C16H22N2OS |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane hydroxide |
| InChIKey | ICHKRSFQNUTAPP-UHFFFAOYSA-M |
| SMILES | C1CC[N+]2(C1)CCN(CC2)C3=C4C=CSC4=CC=C3.[OH-] |
Computed by PubChem (NCBI)