CAS 2760370-09-8 is the registry number for rel-5-((2S,5S)-4-Isopropoxy-5-methylpiperidin-2-yl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2S,5S)-5-methyl-4-propan-2-yloxypiperidin-2-yl]-1,3-benzothiazole (CAS 2760370-09-8) is a chemical compound with the molecular formula C16H22N2OS and a molecular weight of 290.4 g/mol. IUPAC name: 5-[(2S,5S)-5-methyl-4-propan-2-yloxypiperidin-2-yl]-1,3-benzothiazole. InChIKey: ZFBJPOQUNUUPFM-HEIKZBPMSA-N.
| Molecular formula | C16H22N2OS |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 5-[(2S,5S)-5-methyl-4-propan-2-yloxypiperidin-2-yl]-1,3-benzothiazole |
| InChIKey | ZFBJPOQUNUUPFM-HEIKZBPMSA-N |
| SMILES | C[C@H]1CN[C@@H](CC1OC(C)C)C2=CC3=C(C=C2)SC=N3 |
Computed by PubChem (NCBI)