CAS 255051-43-5 appears in our catalog under these names: 3-(Trifluoromethyl)-1-naphthoic acid, 97%, 3-(Trifluoromethyl)naphthalene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 0,5g.
3-(trifluoromethyl)naphthalene-1-carboxylic acid (CAS 255051-43-5) is a chemical compound with the molecular formula C12H7F3O2 and a molecular weight of 240.18 g/mol. IUPAC name: 3-(trifluoromethyl)naphthalene-1-carboxylic acid. InChIKey: JHQSTCZNVIOSDS-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O2 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 3-(trifluoromethyl)naphthalene-1-carboxylic acid |
| InChIKey | JHQSTCZNVIOSDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)