CAS 852103-60-7 appears in our catalog under these names: 1-(Trifluoromethyl)naphthalene-8-carboxylic acid, 95+%, 8-(Trifluoromethyl)-1-naphthoic acid, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
8-(trifluoromethyl)naphthalene-1-carboxylic acid (CAS 852103-60-7) is a chemical compound with the molecular formula C12H7F3O2 and a molecular weight of 240.18 g/mol. IUPAC name: 8-(trifluoromethyl)naphthalene-1-carboxylic acid. InChIKey: RFZGWQTZWDTQDY-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O2 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 8-(trifluoromethyl)naphthalene-1-carboxylic acid |
| InChIKey | RFZGWQTZWDTQDY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)