CAS 2554380-35-5 appears in our catalog under these names: (R)-1-(4-Bromo-2-methylphenyl)ethanamine hydrochloride, 98%, 98%, (R)-1-(4-Bromo-2-methylphenyl)ethanamine hydrochloride, 98%, (R)-1-(4-Bromo-2-methylphenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(1R)-1-(4-bromo-2-methylphenyl)ethanamine;hydrochloride (CAS 2554380-35-5) is a chemical compound with the molecular formula C9H13BrClN and a molecular weight of 250.56 g/mol. IUPAC name: (1R)-1-(4-bromo-2-methylphenyl)ethanamine;hydrochloride. InChIKey: VPQKYPUUMKIBFM-OGFXRTJISA-N.
| Molecular formula | C9H13BrClN |
|---|---|
| Molecular weight | 250.56 g/mol |
| IUPAC name | (1R)-1-(4-bromo-2-methylphenyl)ethanamine;hydrochloride |
| InChIKey | VPQKYPUUMKIBFM-OGFXRTJISA-N |
| SMILES | CC1=C(C=CC(=C1)Br)[C@@H](C)N.Cl |
Computed by PubChem (NCBI)