Products 255706-13-9
CAS 255706-13-9 appears in our catalog under these names: Dabigatran Impurity 25, Dabigatran Impurity 28, Dabigatran Etexilate Impurity Y, Hexyl ((4-aminophenyl)(imino)methyl)carbamate 95%, Des-(ethyl 3-(N-(pyridin-2-yl)-1H-benzo[d]imidazole-5-carboxamido)propanoate Dabigatran Etexilate, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
Hexyl (NZ)-N-[amino-(4-aminophenyl)methylidene]carbamate (CAS 255706-13-9) is a chemical compound with the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. IUPAC name: hexyl (NZ)-N-[amino-(4-aminophenyl)methylidene]carbamate. InChIKey: QNEVYUOYQNDIEJ-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O2 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | hexyl (NZ)-N-[amino-(4-aminophenyl)methylidene]carbamate |
| InChIKey | QNEVYUOYQNDIEJ-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)/N=C(/C1=CC=C(C=C1)N)\N |
Computed by PubChem (NCBI)