CAS 255715-89-0 is the registry number for 5-Mercapto-3-(p-tolyl)-1,3,4-thiadiazole-2(3H)-thione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione (CAS 255715-89-0) is a chemical compound with the molecular formula C9H8N2S3 and a molecular weight of 240.4 g/mol. IUPAC name: 3-(4-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione. InChIKey: JRIZRBUYWMWWCM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S3 |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 3-(4-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione |
| InChIKey | JRIZRBUYWMWWCM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=S)SC(=S)N2 |
Computed by PubChem (NCBI)