CAS 4858-36-0 appears in our catalog under these names: 5–(Benzylthio)–1,3,4–thiadiazole–2–thiol, 5-(Benzylthio)-1,3,4-thiadiazole-2-thiol, 95%, 95%, 5-Benzylthio-1,3,4-thiadiazole-2-thiol, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione (CAS 4858-36-0) is a chemical compound with the molecular formula C9H8N2S3 and a molecular weight of 240.4 g/mol. IUPAC name: 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione. InChIKey: UBLXSSRRVRLOEO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S3 |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | UBLXSSRRVRLOEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NNC(=S)S2 |
Computed by PubChem (NCBI)