Products 255734-04-4
CAS 255734-04-4 is the registry number for KUC-7322. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2,5-dimethylphenoxy]acetic acid (CAS 255734-04-4) is a chemical compound with the molecular formula C21H27NO5 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2,5-dimethylphenoxy]acetic acid. InChIKey: VMMYRRFPMAGXNP-BTYIYWSLSA-N.
| Molecular formula | C21H27NO5 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2,5-dimethylphenoxy]acetic acid |
| InChIKey | VMMYRRFPMAGXNP-BTYIYWSLSA-N |
| SMILES | CC1=CC(=C(C=C1OCC(=O)O)C)CCN[C@@H](C)[C@@H](C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)