CAS 2561-97-9 is the registry number for BIS(4-(TERT-BUTYL)PHENYL) CARBONATE, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 5g.
Bis(4-tert-butylphenyl) carbonate (CAS 2561-97-9) is a chemical compound with the molecular formula C21H26O3 and a molecular weight of 326.4 g/mol. IUPAC name: bis(4-tert-butylphenyl) carbonate. InChIKey: WMEZDESZXBGWCU-UHFFFAOYSA-N.
| Molecular formula | C21H26O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | bis(4-tert-butylphenyl) carbonate |
| InChIKey | WMEZDESZXBGWCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC(=O)OC2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)