Products 2561-97-9

CAS 2561-97-9 is the registry number for BIS(4-(TERT-BUTYL)PHENYL) CARBONATE, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Bis(4-tert-butylphenyl) carbonate (CAS 2561-97-9) is a chemical compound with the molecular formula C21H26O3 and a molecular weight of 326.4 g/mol. IUPAC name: bis(4-tert-butylphenyl) carbonate. InChIKey: WMEZDESZXBGWCU-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26O3
Molecular weight326.4 g/mol
IUPAC namebis(4-tert-butylphenyl) carbonate
InChIKeyWMEZDESZXBGWCU-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)OC(=O)OC2=CC=C(C=C2)C(C)(C)C

Computed by PubChem (NCBI)