CAS 25627-20-7 is the registry number for 2-(2,4,6-Trimethylphenyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,4,6-trimethylphenyl)aniline (CAS 25627-20-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)aniline. InChIKey: DUMUZNITRKJEPV-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)aniline |
| InChIKey | DUMUZNITRKJEPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CC=CC=C2N)C |
Computed by PubChem (NCBI)