CAS 256391-56-7 is the registry number for 1-(1-Benzyl-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one. Offered by: Biosynth. Available pack sizes: 500mg.
1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone (CAS 256391-56-7) is a chemical compound with the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. IUPAC name: 1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone. InChIKey: FLIPGOAKSVPLIH-UHFFFAOYSA-N.
| Molecular formula | C17H12F3NO |
|---|---|
| Molecular weight | 303.28 g/mol |
| IUPAC name | 1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | FLIPGOAKSVPLIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)