CAS 59050-39-4 is the registry number for 2,2,2-Trifluoro-1-(1-methyl-2-phenyl-1H-indol-3-yl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2,2,2-trifluoro-1-(1-methyl-2-phenylindol-3-yl)ethanone (CAS 59050-39-4) is a chemical compound with the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1-methyl-2-phenylindol-3-yl)ethanone. InChIKey: RYVQJWGQXKFWEO-UHFFFAOYSA-N.
| Molecular formula | C17H12F3NO |
|---|---|
| Molecular weight | 303.28 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1-methyl-2-phenylindol-3-yl)ethanone |
| InChIKey | RYVQJWGQXKFWEO-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C1C3=CC=CC=C3)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)