CAS 25641-98-9 appears in our catalog under these names: 3,5-Dichlorophthalic acid, 95%, 3,5-Dichlorophthalic acid, 95+%, 3,5–Dichlorophthalic acid, 3,5-Dichlorophthalic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3,5-dichlorophthalic acid (CAS 25641-98-9) is a chemical compound with the molecular formula C8H4Cl2O4 and a molecular weight of 235.02 g/mol. IUPAC name: 3,5-dichlorophthalic acid. InChIKey: WBICPKUOCCNWQP-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O4 |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 3,5-dichlorophthalic acid |
| InChIKey | WBICPKUOCCNWQP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)