CAS 56962-06-2 appears in our catalog under these names: 3,4-Dichlorophthalic acid, 95%, 3,4-Dichlorophthalic Acid, ≥95%, ≥95%, 3,4-DICHLOROPHTHALIC ACID, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg.
3,4-dichlorophthalic acid (CAS 56962-06-2) is a chemical compound with the molecular formula C8H4Cl2O4 and a molecular weight of 235.02 g/mol. IUPAC name: 3,4-dichlorophthalic acid. InChIKey: YUDBKSANIWMLCU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O4 |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 3,4-dichlorophthalic acid |
| InChIKey | YUDBKSANIWMLCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)