CAS 25646-77-9 appears in our catalog under these names: 2-((4-Amino-3-methylphenyl)(ethyl)amino)ethanol sulfate, 98%, 4–(N–Ethyl–N–2–hydroxyethyl)–2–methylphenylenediamine sulfate, PPD-44 sulfate 98%. Offered by: Chemat Brand, GLPBio, Ambeed. Available pack sizes: on request, 100g, 25g, 500g.
2-(4-amino-N-ethyl-3-methylanilino)ethanol;sulfuric acid (CAS 25646-77-9) is a chemical compound with the molecular formula C11H20N2O5S and a molecular weight of 292.35 g/mol. IUPAC name: 2-(4-amino-N-ethyl-3-methylanilino)ethanol;sulfuric acid. InChIKey: GVEYRUKUJCHJSR-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O5S |
|---|---|
| Molecular weight | 292.35 g/mol |
| IUPAC name | 2-(4-amino-N-ethyl-3-methylanilino)ethanol;sulfuric acid |
| InChIKey | GVEYRUKUJCHJSR-UHFFFAOYSA-N |
| SMILES | CCN(CCO)C1=CC(=C(C=C1)N)C.OS(=O)(=O)O |
Computed by PubChem (NCBI)